C21H16Cl2N4OS — CID 135435341
(5E)-2-(2,6-dichlorophenyl)imino-5-[[4-(dimethylamino)quinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135435341) has the molecular formula C21H16Cl2N4OS and a molecular weight of 443.36 g/mol. Its IUPAC name is (5E)-2-(2,6-dichlorophenyl)imino-5-[[4-(dimethylamino)quinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,6-dichlorophenyl)imino-5-[[4-(dimethylamino)quinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135435341 |
| Molecular Formula | C21H16Cl2N4OS |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (5E)-2-(2,6-dichlorophenyl)imino-5-[[4-(dimethylamino)quinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccnc2ccc(/C=C3/S/C(=N\c4c(Cl)cccc4Cl)NC3=O)cc12 |
| InChI | InChI=1S/C21H16Cl2N4OS/c1-27(2)17-8-9-24-16-7-6-12(10-13(16)17)11-18-20(28)26-21(29-18)25-19-14(22)4-3-5-15(19)23/h3-11H,1-2H3,(H,25,26,28)/b18-11+ |
| InChIKey | OYWVVJBUKKUWSB-WOJGMQOQSA-N |
| XLogP | 5.50 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|