C24H20Cl2N4OS — CID 135435364
(5Z)-2-(2,6-dichlorophenyl)imino-5-[(4-piperidin-1-ylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135435364) has the molecular formula C24H20Cl2N4OS and a molecular weight of 483.42 g/mol. Its IUPAC name is (5Z)-2-(2,6-dichlorophenyl)imino-5-[(4-piperidin-1-ylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,6-dichlorophenyl)imino-5-[(4-piperidin-1-ylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135435364 |
| Molecular Formula | C24H20Cl2N4OS |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | (5Z)-2-(2,6-dichlorophenyl)imino-5-[(4-piperidin-1-ylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)S/C1=C\c1ccc2nccc(N3CCCCC3)c2c1 |
| InChI | InChI=1S/C24H20Cl2N4OS/c25-17-5-4-6-18(26)22(17)28-24-29-23(31)21(32-24)14-15-7-8-19-16(13-15)20(9-10-27-19)30-11-2-1-3-12-30/h4-10,13-14H,1-3,11-12H2,(H,28,29,31)/b21-14- |
| InChIKey | HGGQWOAWLWZDOT-STZFKDTASA-N |
| XLogP | 6.42 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|