C26H24N4O2S — CID 135989917
(5Z)-5-[(4-morpholin-4-ylquinolin-6-yl)methylidene]-2-[(1S,2R)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one (PubChem CID 135989917) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is (5Z)-5-[(4-morpholin-4-ylquinolin-6-yl)methylidene]-2-[(1S,2R)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-morpholin-4-ylquinolin-6-yl)methylidene]-2-[(1S,2R)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989917 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (5Z)-5-[(4-morpholin-4-ylquinolin-6-yl)methylidene]-2-[(1S,2R)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\[C@H]2C[C@@H]2c2ccccc2)S/C1=C\c1ccc2nccc(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C26H24N4O2S/c31-25-24(33-26(29-25)28-22-16-19(22)18-4-2-1-3-5-18)15-17-6-7-21-20(14-17)23(8-9-27-21)30-10-12-32-13-11-30/h1-9,14-15,19,22H,10-13,16H2,(H,28,29,31)/b24-15-/t19-,22+/m1/s1 |
| InChIKey | QJBAVOJWEDDJCI-LPYFCFJWSA-N |
| XLogP | 4.19 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|