C19H19N3O2S — CID 135452411
(5Z)-2-(oxan-4-ylmethylimino)-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135452411) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is (5Z)-2-(oxan-4-ylmethylimino)-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(oxan-4-ylmethylimino)-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135452411 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (5Z)-2-(oxan-4-ylmethylimino)-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\CC2CCOCC2)S/C1=C\c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H19N3O2S/c23-18-17(11-14-3-4-16-15(10-14)2-1-7-20-16)25-19(22-18)21-12-13-5-8-24-9-6-13/h1-4,7,10-11,13H,5-6,8-9,12H2,(H,21,22,23)/b17-11- |
| InChIKey | SIQABRBTOCRAPW-BOPFTXTBSA-N |
| XLogP | 3.22 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|