C21H18N4O3S2 — CID 136504652
4-[2-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]ethyl]benzenesulfonamide (PubChem CID 136504652) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[2-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 136504652 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-[2-[[4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC/N=C2\NC(=O)C(=Cc3ccc4ncccc4c3)S2)cc1 |
| InChI | InChI=1S/C21H18N4O3S2/c22-30(27,28)17-6-3-14(4-7-17)9-11-24-21-25-20(26)19(29-21)13-15-5-8-18-16(12-15)2-1-10-23-18/h1-8,10,12-13H,9,11H2,(H2,22,27,28)(H,24,25,26) |
| InChIKey | LDRZDNNEWBIWCQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|