C29H29N3O2S — CID 135428028
(5Z)-5-[[4-(cyclohexylmethoxy)quinolin-6-yl]methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one (PubChem CID 135428028) has the molecular formula C29H29N3O2S and a molecular weight of 483.64 g/mol. Its IUPAC name is (5Z)-5-[[4-(cyclohexylmethoxy)quinolin-6-yl]methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(cyclohexylmethoxy)quinolin-6-yl]methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135428028 |
| Molecular Formula | C29H29N3O2S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (5Z)-5-[[4-(cyclohexylmethoxy)quinolin-6-yl]methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\[C@@H]2C[C@H]2c2ccccc2)S/C1=C\c1ccc2nccc(OCC3CCCCC3)c2c1 |
| InChI | InChI=1S/C29H29N3O2S/c33-28-27(35-29(32-28)31-25-17-22(25)21-9-5-2-6-10-21)16-20-11-12-24-23(15-20)26(13-14-30-24)34-18-19-7-3-1-4-8-19/h2,5-6,9-16,19,22,25H,1,3-4,7-8,17-18H2,(H,31,32,33)/b27-16-/t22-,25+/m0/s1 |
| InChIKey | FNBRNODAIKGSKL-AZNYYERGSA-N |
| XLogP | 6.31 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|