C23H21N3O3S — CID 136631016
5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[(1R)-2-hydroxy-1-phenylethyl]imino-1,3-thiazolidin-4-one (PubChem CID 136631016) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[(1R)-2-hydroxy-1-phenylethyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[(1R)-2-hydroxy-1-phenylethyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136631016 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[(1R)-2-hydroxy-1-phenylethyl]imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccnc2ccc(C=C3S/C(=N\[C@@H](CO)c4ccccc4)NC3=O)cc12 |
| InChI | InChI=1S/C23H21N3O3S/c1-2-29-20-10-11-24-18-9-8-15(12-17(18)20)13-21-22(28)26-23(30-21)25-19(14-27)16-6-4-3-5-7-16/h3-13,19,27H,2,14H2,1H3,(H,25,26,28)/t19-/m0/s1 |
| InChIKey | QHEUPFFFLIUTBR-IBGZPJMESA-N |
| XLogP | 3.93 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|