C23H20FN3O2S — CID 135989934
(5Z)-5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[2-(3-fluorophenyl)ethylimino]-1,3-thiazolidin-4-one (PubChem CID 135989934) has the molecular formula C23H20FN3O2S and a molecular weight of 421.50 g/mol. Its IUPAC name is (5Z)-5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[2-(3-fluorophenyl)ethylimino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[2-(3-fluorophenyl)ethylimino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989934 |
| Molecular Formula | C23H20FN3O2S |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (5Z)-5-[(4-ethoxyquinolin-6-yl)methylidene]-2-[2-(3-fluorophenyl)ethylimino]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccnc2ccc(/C=C3\S/C(=N/CCc4cccc(F)c4)NC3=O)cc12 |
| InChI | InChI=1S/C23H20FN3O2S/c1-2-29-20-9-11-25-19-7-6-16(13-18(19)20)14-21-22(28)27-23(30-21)26-10-8-15-4-3-5-17(24)12-15/h3-7,9,11-14H,2,8,10H2,1H3,(H,26,27,28)/b21-14- |
| InChIKey | DSWFEGINLLKKAA-STZFKDTASA-N |
| XLogP | 4.58 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|