C15H13N3O2S — CID 76839176
2-amino-5-[(4-ethoxyquinolin-6-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 76839176) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-amino-5-[(4-ethoxyquinolin-6-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(4-ethoxyquinolin-6-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76839176 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-amino-5-[(4-ethoxyquinolin-6-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCOc1ccnc2ccc(C=C3SC(N)=NC3=O)cc12 |
| InChI | InChI=1S/C15H13N3O2S/c1-2-20-12-5-6-17-11-4-3-9(7-10(11)12)8-13-14(19)18-15(16)21-13/h3-8H,2H2,1H3,(H2,16,18,19) |
| InChIKey | SLOBPQCWMPAEJA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|