C19H17FN2O3S — CID 96867367
(5Z)-2-amino-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 96867367) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 96867367 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (5Z)-2-amino-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | CCOc1cc(/C=C2\SC(N)=NC2=O)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C19H17FN2O3S/c1-2-24-16-9-12(10-17-18(23)22-19(21)26-17)7-8-15(16)25-11-13-5-3-4-6-14(13)20/h3-10H,2,11H2,1H3,(H2,21,22,23)/b17-10- |
| InChIKey | RUDQWCGZJHRXKX-YVLHZVERSA-N |
| XLogP | 3.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|