C17H11Cl2FN2O2S — CID 7376388
(5E)-2-amino-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 7376388) has the molecular formula C17H11Cl2FN2O2S and a molecular weight of 397.26 g/mol. Its IUPAC name is (5E)-2-amino-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-amino-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7376388 |
| Molecular Formula | C17H11Cl2FN2O2S |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | (5E)-2-amino-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)/C(=C\c2cc(Cl)c(OCc3ccccc3F)c(Cl)c2)S1 |
| InChI | InChI=1S/C17H11Cl2FN2O2S/c18-11-5-9(7-14-16(23)22-17(21)25-14)6-12(19)15(11)24-8-10-3-1-2-4-13(10)20/h1-7H,8H2,(H2,21,22,23)/b14-7+ |
| InChIKey | USAXCZRXYYYYLK-VGOFMYFVSA-N |
| XLogP | 4.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|