C22H18Cl2FNO5S — CID 126101931
propan-2-yl 2-[(5E)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126101931) has the molecular formula C22H18Cl2FNO5S and a molecular weight of 498.36 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126101931 |
| Molecular Formula | C22H18Cl2FNO5S |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccccc3F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C22H18Cl2FNO5S/c1-12(2)31-19(27)10-26-21(28)18(32-22(26)29)9-13-7-15(23)20(16(24)8-13)30-11-14-5-3-4-6-17(14)25/h3-9,12H,10-11H2,1-2H3/b18-9+ |
| InChIKey | HUYPHIAVGWBCRV-GIJQJNRQSA-N |
| XLogP | 5.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|