C24H21BrClFN2O4S — CID 126381496
(5Z)-5-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126381496) has the molecular formula C24H21BrClFN2O4S and a molecular weight of 567.86 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126381496 |
| Molecular Formula | C24H21BrClFN2O4S |
| Molecular Weight | 567.86 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-chloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cc(Cl)c(OCc3ccccc3F)c(Br)c2)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C24H21BrClFN2O4S/c25-17-10-15(11-18(26)22(17)33-14-16-6-2-3-7-19(16)27)12-20-23(31)29(24(32)34-20)13-21(30)28-8-4-1-5-9-28/h2-3,6-7,10-12H,1,4-5,8-9,13-14H2/b20-12- |
| InChIKey | BURBFVFKZZRZSE-NDENLUEZSA-N |
| XLogP | 5.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|