C22H18BrCl2NO5S — CID 126104821
propan-2-yl 2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126104821) has the molecular formula C22H18BrCl2NO5S and a molecular weight of 559.27 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126104821 |
| Molecular Formula | C22H18BrCl2NO5S |
| Molecular Weight | 559.27 g/mol |
| Exact Mass | 556.95 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2cc(Cl)c(OCc3ccc(Cl)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C22H18BrCl2NO5S/c1-12(2)31-19(27)10-26-21(28)18(32-22(26)29)9-14-7-16(23)20(17(25)8-14)30-11-13-3-5-15(24)6-4-13/h3-9,12H,10-11H2,1-2H3/b18-9+ |
| InChIKey | OYMQXEBYDQAYIC-GIJQJNRQSA-N |
| XLogP | 6.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.27 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|