C19H15Cl3N2O3S — CID 5350257
(5Z)-2-amino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 5350257) has the molecular formula C19H15Cl3N2O3S and a molecular weight of 457.77 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 5350257 |
| Molecular Formula | C19H15Cl3N2O3S |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | (5Z)-2-amino-5-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | CCOc1cc(/C=C2\SC(N)=NC2=O)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl3N2O3S/c1-2-26-15-6-10(7-16-18(25)24-19(23)28-16)5-14(22)17(15)27-9-11-3-4-12(20)8-13(11)21/h3-8H,2,9H2,1H3,(H2,23,24,25)/b16-7- |
| InChIKey | IGASRKHQDOHIRH-APSNUPSMSA-N |
| XLogP | 5.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|