C14H13ClN2O5S — CID 4284194
2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]acetic acid (PubChem CID 4284194) has the molecular formula C14H13ClN2O5S and a molecular weight of 356.79 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 4284194 |
| Molecular Formula | C14H13ClN2O5S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C=C2SC(N)=NC2=O)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C14H13ClN2O5S/c1-2-21-9-4-7(5-10-13(20)17-14(16)23-10)3-8(15)12(9)22-6-11(18)19/h3-5H,2,6H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | ZIYGICGKBAVFLH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|