C16H17IN2O5S — CID 3373626
ethyl 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 3373626) has the molecular formula C16H17IN2O5S and a molecular weight of 476.29 g/mol. Its IUPAC name is ethyl 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 3373626 |
| Molecular Formula | C16H17IN2O5S |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | ethyl 2-[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=C2SC(N)=NC2=O)cc1OCC |
| InChI | InChI=1S/C16H17IN2O5S/c1-3-22-11-6-9(7-12-15(21)19-16(18)25-12)5-10(17)14(11)24-8-13(20)23-4-2/h5-7H,3-4,8H2,1-2H3,(H2,18,19,21) |
| InChIKey | NCUPQKUODLMLRE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|