C14H11IN2O3S — CID 4576742
2-amino-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 4576742) has the molecular formula C14H11IN2O3S and a molecular weight of 414.22 g/mol. Its IUPAC name is 2-amino-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4576742 |
| Molecular Formula | C14H11IN2O3S |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2-amino-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | C#CCOc1c(I)cc(C=C2SC(N)=NC2=O)cc1OC |
| InChI | InChI=1S/C14H11IN2O3S/c1-3-4-20-12-9(15)5-8(6-10(12)19-2)7-11-13(18)17-14(16)21-11/h1,5-7H,4H2,2H3,(H2,16,17,18) |
| InChIKey | XXGOQSWSRXYDNW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|