C17H16INO5S — CID 126139986
(5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126139986) has the molecular formula C17H16INO5S and a molecular weight of 473.29 g/mol. Its IUPAC name is (5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126139986 |
| Molecular Formula | C17H16INO5S |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | (5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1c(I)cc(/C=C2/SC(=O)N(CCOC)C2=O)cc1OC |
| InChI | InChI=1S/C17H16INO5S/c1-4-6-24-15-12(18)8-11(9-13(15)23-3)10-14-16(20)19(5-7-22-2)17(21)25-14/h1,8-10H,5-7H2,2-3H3/b14-10+ |
| InChIKey | MHYBKGJAFIVRRI-GXDHUFHOSA-N |
| XLogP | 2.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|