C20H13ClINO4S — CID 126201198
(5E)-3-(4-chlorophenyl)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126201198) has the molecular formula C20H13ClINO4S and a molecular weight of 525.75 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126201198 |
| Molecular Formula | C20H13ClINO4S |
| Molecular Weight | 525.75 g/mol |
| Exact Mass | 524.93 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1c(I)cc(/C=C2/SC(=O)N(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H13ClINO4S/c1-3-8-27-18-15(22)9-12(10-16(18)26-2)11-17-19(24)23(20(25)28-17)14-6-4-13(21)5-7-14/h1,4-7,9-11H,8H2,2H3/b17-11+ |
| InChIKey | RLJOFGNZMMANQE-GZTJUZNOSA-N |
| XLogP | 5.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|