C18H16INO6S — CID 126118989
methyl (2R)-2-[(5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126118989) has the molecular formula C18H16INO6S and a molecular weight of 501.30 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126118989 |
| Molecular Formula | C18H16INO6S |
| Molecular Weight | 501.30 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C#CCOc1c(I)cc(/C=C2/SC(=O)N([C@H](C)C(=O)OC)C2=O)cc1OC |
| InChI | InChI=1S/C18H16INO6S/c1-5-6-26-15-12(19)7-11(8-13(15)24-3)9-14-16(21)20(18(23)27-14)10(2)17(22)25-4/h1,7-10H,6H2,2-4H3/b14-9+/t10-/m1/s1 |
| InChIKey | FXSISOIEYVADSY-GMROUXNLSA-N |
| XLogP | 2.91 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|