C17H13I2NO5S — CID 126071769
methyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126071769) has the molecular formula C17H13I2NO5S and a molecular weight of 597.17 g/mol. Its IUPAC name is methyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126071769 |
| Molecular Formula | C17H13I2NO5S |
| Molecular Weight | 597.17 g/mol |
| Exact Mass | 596.86 |
| IUPAC Name | methyl (2S)-2-[(5E)-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | C#CCOc1c(I)cc(/C=C2/SC(=O)N([C@@H](C)C(=O)OC)C2=O)cc1I |
| InChI | InChI=1S/C17H13I2NO5S/c1-4-5-25-14-11(18)6-10(7-12(14)19)8-13-15(21)20(17(23)26-13)9(2)16(22)24-3/h1,6-9H,5H2,2-3H3/b13-8+/t9-/m0/s1 |
| InChIKey | LIISNSWYUCEDLF-ITTMYVLYSA-N |
| XLogP | 3.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|