C12H11IN2O3S — CID 1369204
(5Z)-2-amino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 1369204) has the molecular formula C12H11IN2O3S and a molecular weight of 390.20 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1369204 |
| Molecular Formula | C12H11IN2O3S |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | (5Z)-2-amino-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCOc1cc(/C=C2\SC(N)=NC2=O)cc(I)c1O |
| InChI | InChI=1S/C12H11IN2O3S/c1-2-18-8-4-6(3-7(13)10(8)16)5-9-11(17)15-12(14)19-9/h3-5,16H,2H2,1H3,(H2,14,15,17)/b9-5- |
| InChIKey | ZNHAWKGOTOEECZ-UITAMQMPSA-N |
| XLogP | 2.32 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|