C19H16INO4S — CID 124662921
(5E)-3-benzyl-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124662921) has the molecular formula C19H16INO4S and a molecular weight of 481.31 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124662921 |
| Molecular Formula | C19H16INO4S |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | (5E)-3-benzyl-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccccc3)C2=O)cc(I)c1O |
| InChI | InChI=1S/C19H16INO4S/c1-2-25-15-9-13(8-14(20)17(15)22)10-16-18(23)21(19(24)26-16)11-12-6-4-3-5-7-12/h3-10,22H,2,11H2,1H3/b16-10+ |
| InChIKey | HZLQNCIABVMQTE-MHWRWJLKSA-N |
| XLogP | 4.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|