C22H21IN2O5S — CID 126164684
N-(2,6-dimethylphenyl)-2-[(5E)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126164684) has the molecular formula C22H21IN2O5S and a molecular weight of 552.39 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(5E)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(5E)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126164684 |
| Molecular Formula | C22H21IN2O5S |
| Molecular Weight | 552.39 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(5E)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3c(C)cccc3C)C2=O)cc(I)c1O |
| InChI | InChI=1S/C22H21IN2O5S/c1-4-30-16-9-14(8-15(23)20(16)27)10-17-21(28)25(22(29)31-17)11-18(26)24-19-12(2)6-5-7-13(19)3/h5-10,27H,4,11H2,1-3H3,(H,24,26)/b17-10+ |
| InChIKey | SSVAAIPDLVBVEL-LICLKQGHSA-N |
| XLogP | 4.69 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|