C16H13IN2O3S2 — CID 126343812
(2Z,4S)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 126343812) has the molecular formula C16H13IN2O3S2 and a molecular weight of 472.33 g/mol. Its IUPAC name is (2Z,4S)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4S)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 126343812 |
| Molecular Formula | C16H13IN2O3S2 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.94 |
| IUPAC Name | (2Z,4S)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc(I)c(O)c(OCC)c2)C(=O)[C@@H]1c1nccs1 |
| InChI | InChI=1S/C16H13IN2O3S2/c1-2-22-10-6-8(5-9(17)13(10)20)7-11-14(21)12(15(18)24-11)16-19-3-4-23-16/h3-7,12,18,20H,2H2,1H3/b11-7-,18-15-/t12-/m0/s1 |
| InChIKey | XUFBBBPVSONOCE-INHQFFIBSA-N |
| XLogP | 4.27 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|