C19H19IN4O4S2 — CID 126343773
2-[2-ethoxy-4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]-6-iodophenoxy]acetamide (PubChem CID 126343773) has the molecular formula C19H19IN4O4S2 and a molecular weight of 558.42 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]-6-iodophenoxy]acetamide.
| Compound Name | 2-[2-ethoxy-4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]-6-iodophenoxy]acetamide |
|---|---|
| PubChem CID | 126343773 |
| Molecular Formula | C19H19IN4O4S2 |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]-6-iodophenoxy]acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2cc(I)c(OCC(N)=O)c(OCC)c2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C19H19IN4O4S2/c1-3-14-23-24-19(30-14)15-16(26)12(29-18(15)22)7-9-5-10(20)17(28-8-13(21)25)11(6-9)27-4-2/h5-7,15,22H,3-4,8H2,1-2H3,(H2,21,25)/b12-7-,22-18-/t15-/m0/s1 |
| InChIKey | WNZVWDIKOOVUBA-OVXLWWOQSA-N |
| XLogP | 3.39 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|