C24H21Br2N3O3S2 — CID 126343823
(2Z,4S)-2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 126343823) has the molecular formula C24H21Br2N3O3S2 and a molecular weight of 623.39 g/mol. Its IUPAC name is (2Z,4S)-2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 126343823 |
| Molecular Formula | C24H21Br2N3O3S2 |
| Molecular Weight | 623.39 g/mol |
| Exact Mass | 620.94 |
| IUPAC Name | (2Z,4S)-2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc(Br)c(OCc3ccc(Br)cc3)c(OCC)c2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C24H21Br2N3O3S2/c1-3-19-28-29-24(34-19)20-21(30)18(33-23(20)27)11-14-9-16(26)22(17(10-14)31-4-2)32-12-13-5-7-15(25)8-6-13/h5-11,20,27H,3-4,12H2,1-2H3/b18-11-,27-23-/t20-/m0/s1 |
| InChIKey | XZOCWLCOLMSPKM-JGBGXQMBSA-N |
| XLogP | 7.02 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.39 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|