C15H13N3O2S2 — CID 124549420
(2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(3-hydroxyphenyl)methylidene]-5-iminothiolan-3-one (PubChem CID 124549420) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(3-hydroxyphenyl)methylidene]-5-iminothiolan-3-one.
| Compound Name | (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(3-hydroxyphenyl)methylidene]-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 124549420 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(3-hydroxyphenyl)methylidene]-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cccc(O)c2)C(=O)[C@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C15H13N3O2S2/c1-2-11-17-18-15(22-11)12-13(20)10(21-14(12)16)7-8-4-3-5-9(19)6-8/h3-7,12,16,19H,2H2,1H3/b10-7-,16-14-/t12-/m1/s1 |
| InChIKey | HRXPNAAWMXNQCZ-LJNPOSGASA-N |
| XLogP | 3.22 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|