C17H16N4O3S2 — CID 124576450
2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetamide (PubChem CID 124576450) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 124576450 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCC(N)=O)cc2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-2-13-20-21-17(26-13)14-15(23)11(25-16(14)19)7-9-3-5-10(6-4-9)24-8-12(18)22/h3-7,14,19H,2,8H2,1H3,(H2,18,22)/b11-7-,19-16-/t14-/m0/s1 |
| InChIKey | NNAOGZZOXVXOEC-FNTYVTIESA-N |
| XLogP | 2.38 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|