C22H18BrN3O2S2 — CID 126340074
(2Z,4S)-2-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 126340074) has the molecular formula C22H18BrN3O2S2 and a molecular weight of 500.44 g/mol. Its IUPAC name is (2Z,4S)-2-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-2-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 126340074 |
| Molecular Formula | C22H18BrN3O2S2 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | (2Z,4S)-2-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3ccccc3)c(Br)c2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C22H18BrN3O2S2/c1-2-18-25-26-22(30-18)19-20(27)17(29-21(19)24)11-14-8-9-16(15(23)10-14)28-12-13-6-4-3-5-7-13/h3-11,19,24H,2,12H2,1H3/b17-11-,24-21-/t19-/m0/s1 |
| InChIKey | GBAPNMWNWOLWLG-QCKSXCMHSA-N |
| XLogP | 5.86 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|