C26H20BrN3O2S2 — CID 126343188
(2Z,4R)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 126343188) has the molecular formula C26H20BrN3O2S2 and a molecular weight of 550.50 g/mol. Its IUPAC name is (2Z,4R)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4R)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 126343188 |
| Molecular Formula | C26H20BrN3O2S2 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.02 |
| IUPAC Name | (2Z,4R)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3cccc4ccccc34)c(Br)c2)C(=O)[C@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C26H20BrN3O2S2/c1-2-22-29-30-26(34-22)23-24(31)21(33-25(23)28)13-15-10-11-20(19(27)12-15)32-14-17-8-5-7-16-6-3-4-9-18(16)17/h3-13,23,28H,2,14H2,1H3/b21-13-,28-25-/t23-/m1/s1 |
| InChIKey | STNAWRKLBSOZMP-YOXMEBNQSA-N |
| XLogP | 7.01 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|