C25H17BrN2O2S2 — CID 126341650
(2Z,4S)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 126341650) has the molecular formula C25H17BrN2O2S2 and a molecular weight of 521.46 g/mol. Its IUPAC name is (2Z,4S)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4S)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 126341650 |
| Molecular Formula | C25H17BrN2O2S2 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | (2Z,4S)-2-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3cccc4ccccc34)c(Br)c2)C(=O)[C@@H]1c1nccs1 |
| InChI | InChI=1S/C25H17BrN2O2S2/c26-19-12-15(13-21-23(29)22(24(27)32-21)25-28-10-11-31-25)8-9-20(19)30-14-17-6-3-5-16-4-1-2-7-18(16)17/h1-13,22,27H,14H2/b21-13-,27-24-/t22-/m0/s1 |
| InChIKey | JFTMPLHCBGBCNW-SNQAQJEMSA-N |
| XLogP | 7.06 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|