C15H10N2O3S2 — CID 124549245
(2Z,4S)-2-(1,3-benzodioxol-5-ylmethylidene)-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 124549245) has the molecular formula C15H10N2O3S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2Z,4S)-2-(1,3-benzodioxol-5-ylmethylidene)-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4S)-2-(1,3-benzodioxol-5-ylmethylidene)-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 124549245 |
| Molecular Formula | C15H10N2O3S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (2Z,4S)-2-(1,3-benzodioxol-5-ylmethylidene)-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc3c(c2)OCO3)C(=O)[C@@H]1c1nccs1 |
| InChI | InChI=1S/C15H10N2O3S2/c16-14-12(15-17-3-4-21-15)13(18)11(22-14)6-8-1-2-9-10(5-8)20-7-19-9/h1-6,12,16H,7H2/b11-6-,16-14-/t12-/m0/s1 |
| InChIKey | AGKNFJBRKKSKCB-JBSCNNSDSA-N |
| XLogP | 3.29 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|