C17H13N3OS2 — CID 124577474
(2Z,4R)-5-imino-2-[(2-methyl-1H-indol-3-yl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 124577474) has the molecular formula C17H13N3OS2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2Z,4R)-5-imino-2-[(2-methyl-1H-indol-3-yl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4R)-5-imino-2-[(2-methyl-1H-indol-3-yl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 124577474 |
| Molecular Formula | C17H13N3OS2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (2Z,4R)-5-imino-2-[(2-methyl-1H-indol-3-yl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2c(C)[nH]c3ccccc23)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C17H13N3OS2/c1-9-11(10-4-2-3-5-12(10)20-9)8-13-15(21)14(16(18)23-13)17-19-6-7-22-17/h2-8,14,18,20H,1H3/b13-8-,18-16-/t14-/m1/s1 |
| InChIKey | NWYPZMWERBAODU-HRCJOTPKSA-N |
| XLogP | 4.35 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|