C20H24N4OS — CID 127273242
N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 127273242) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127273242 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)N1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C20H24N4OS/c1-14-16(17-4-2-3-5-18(17)23-14)6-9-22-20(25)24-11-7-15(8-12-24)19-21-10-13-26-19/h2-5,10,13,15,23H,6-9,11-12H2,1H3,(H,22,25) |
| InChIKey | HKWOEODQSHKUCT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|