C24H29FN4O — CID 86882888
4-[(4-fluorophenyl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,4-diazepane-1-carboxamide (PubChem CID 86882888) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[(4-fluorophenyl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 86882888 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,4-diazepane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)N1CCCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29FN4O/c1-18-21(22-5-2-3-6-23(22)27-18)11-12-26-24(30)29-14-4-13-28(15-16-29)17-19-7-9-20(25)10-8-19/h2-3,5-10,27H,4,11-17H2,1H3,(H,26,30) |
| InChIKey | QFCXDZFMLGLUGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|