C14H22FN3O — CID 143541774
N-ethyl-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide;molecular hydrogen (PubChem CID 143541774) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is N-ethyl-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide;molecular hydrogen.
| Compound Name | N-ethyl-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 143541774 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-ethyl-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide;molecular hydrogen |
| SMILES | CCNC(=O)N1CCN(Cc2ccc(F)cc2)CC1.[H][H] |
| InChI | InChI=1S/C14H20FN3O.H2/c1-2-16-14(19)18-9-7-17(8-10-18)11-12-3-5-13(15)6-4-12;/h3-6H,2,7-11H2,1H3,(H,16,19);1H |
| InChIKey | RQUIKESSZOADGS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |