C20H24FN3O — CID 38159048
N-[(4-fluorophenyl)methyl]-4-[(2-methylphenyl)methyl]piperazine-1-carboxamide (PubChem CID 38159048) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[(2-methylphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[(2-methylphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 38159048 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[(2-methylphenyl)methyl]piperazine-1-carboxamide |
| SMILES | Cc1ccccc1CN1CCN(C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24FN3O/c1-16-4-2-3-5-18(16)15-23-10-12-24(13-11-23)20(25)22-14-17-6-8-19(21)9-7-17/h2-9H,10-15H2,1H3,(H,22,25) |
| InChIKey | AMWMHLUMQZGFBW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |