C19H21F2N3O — CID 27534923
N,4-bis[(2-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 27534923) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is N,4-bis[(2-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N,4-bis[(2-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 27534923 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N,4-bis[(2-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1F)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-17-7-3-1-5-15(17)13-22-19(25)24-11-9-23(10-12-24)14-16-6-2-4-8-18(16)21/h1-8H,9-14H2,(H,22,25) |
| InChIKey | QGUAWSBFJDBXIY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |