C16H25FN4O — CID 113105789
N-[2-(dimethylamino)ethyl]-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 113105789) has the molecular formula C16H25FN4O and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105789 |
| Molecular Formula | C16H25FN4O |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[(2-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H25FN4O/c1-19(2)8-7-18-16(22)21-11-9-20(10-12-21)13-14-5-3-4-6-15(14)17/h3-6H,7-13H2,1-2H3,(H,18,22) |
| InChIKey | NNXCMBBYMYONSN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |