C15H21F3N4O — CID 113105892
N-[2-(dimethylamino)ethyl]-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 113105892) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105892 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)N1CCN(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H21F3N4O/c1-20(2)6-5-19-15(23)22-9-7-21(8-10-22)12-4-3-11(16)13(17)14(12)18/h3-4H,5-10H2,1-2H3,(H,19,23) |
| InChIKey | IGZCHAXTNWQOSW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|