C21H24F3N3O — CID 113112648
N-(2-tert-butylphenyl)-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 113112648) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112648 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(2-tert-butylphenyl)-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)N1CCN(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H24F3N3O/c1-21(2,3)14-6-4-5-7-16(14)25-20(28)27-12-10-26(11-13-27)17-9-8-15(22)18(23)19(17)24/h4-9H,10-13H2,1-3H3,(H,25,28) |
| InChIKey | MWOJOPVEODXIRB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|