C20H26N4O — CID 108990373
N-(2-tert-butylphenyl)-4-pyridin-2-ylpiperazine-1-carboxamide (PubChem CID 108990373) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-4-pyridin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-4-pyridin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108990373 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-(2-tert-butylphenyl)-4-pyridin-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26N4O/c1-20(2,3)16-8-4-5-9-17(16)22-19(25)24-14-12-23(13-15-24)18-10-6-7-11-21-18/h4-11H,12-15H2,1-3H3,(H,22,25) |
| InChIKey | SBKLYIIRDLHIPM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |