C13H15N5OS — CID 47148349
4-pyridin-2-yl-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide (PubChem CID 47148349) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-pyridin-2-yl-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide.
| Compound Name | 4-pyridin-2-yl-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47148349 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-pyridin-2-yl-N-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1nccs1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C13H15N5OS/c19-13(16-12-15-5-10-20-12)18-8-6-17(7-9-18)11-3-1-2-4-14-11/h1-5,10H,6-9H2,(H,15,16,19) |
| InChIKey | VNKNEXMWSKNPHH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |