C8H12N4OS — CID 127561429
N-(1,3-thiazol-2-yl)piperazine-1-carboxamide (PubChem CID 127561429) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)piperazine-1-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 127561429 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-(1,3-thiazol-2-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1nccs1)N1CCNCC1 |
| InChI | InChI=1S/C8H12N4OS/c13-8(11-7-10-3-6-14-7)12-4-1-9-2-5-12/h3,6,9H,1-2,4-5H2,(H,10,11,13) |
| InChIKey | XBJIBICZCQWANT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |