C11H13N5OS — CID 126946395
3-pyrazol-1-yl-N-(1,3-thiazol-2-yl)pyrrolidine-1-carboxamide (PubChem CID 126946395) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-(1,3-thiazol-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | 3-pyrazol-1-yl-N-(1,3-thiazol-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126946395 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-pyrazol-1-yl-N-(1,3-thiazol-2-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1nccs1)N1CCC(n2cccn2)C1 |
| InChI | InChI=1S/C11H13N5OS/c17-11(14-10-12-4-7-18-10)15-6-2-9(8-15)16-5-1-3-13-16/h1,3-5,7,9H,2,6,8H2,(H,12,14,17) |
| InChIKey | KSPNLCOZKXRWSE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |