C14H17N5O2S — CID 99602928
N-(5-methyl-1,3-thiazol-2-yl)-2-oxo-2-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]acetamide (PubChem CID 99602928) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-oxo-2-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]acetamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-oxo-2-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 99602928 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-oxo-2-[(3S)-3-pyrazol-1-ylpiperidin-1-yl]acetamide |
| SMILES | Cc1cnc(NC(=O)C(=O)N2CCC[C@H](n3cccn3)C2)s1 |
| InChI | InChI=1S/C14H17N5O2S/c1-10-8-15-14(22-10)17-12(20)13(21)18-6-2-4-11(9-18)19-7-3-5-16-19/h3,5,7-8,11H,2,4,6,9H2,1H3,(H,15,17,20)/t11-/m0/s1 |
| InChIKey | UHXWKNLZICQWSA-NSHDSACASA-N |
| XLogP | 1.45 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|