C15H18N4O2 — CID 95383189
1-methyl-3-[(3S)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyridin-2-one (PubChem CID 95383189) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-methyl-3-[(3S)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyridin-2-one.
| Compound Name | 1-methyl-3-[(3S)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 95383189 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-methyl-3-[(3S)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyridin-2-one |
| SMILES | Cn1cccc(C(=O)N2CCC[C@H](n3cccn3)C2)c1=O |
| InChI | InChI=1S/C15H18N4O2/c1-17-8-3-6-13(14(17)20)15(21)18-9-2-5-12(11-18)19-10-4-7-16-19/h3-4,6-8,10,12H,2,5,9,11H2,1H3/t12-/m0/s1 |
| InChIKey | MSNCIZXKLZHYFA-LBPRGKRZSA-N |
| XLogP | 1.06 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |