C12H16N2O3 — CID 129470841
3-[(3R)-3-hydroxypiperidine-1-carbonyl]-1-methylpyridin-2-one (PubChem CID 129470841) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[(3R)-3-hydroxypiperidine-1-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 3-[(3R)-3-hydroxypiperidine-1-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 129470841 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-[(3R)-3-hydroxypiperidine-1-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cn1cccc(C(=O)N2CCC[C@@H](O)C2)c1=O |
| InChI | InChI=1S/C12H16N2O3/c1-13-6-3-5-10(11(13)16)12(17)14-7-2-4-9(15)8-14/h3,5-6,9,15H,2,4,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | OGZCNEUUMZEJAO-SECBINFHSA-N |
| XLogP | -0.02 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |